C8H10ClN3O3 — CID 137007500
methyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]acetate (PubChem CID 137007500) has the molecular formula C8H10ClN3O3 and a molecular weight of 231.64 g/mol. Its IUPAC name is methyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]acetate.
| Compound Name | methyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]acetate |
|---|---|
| PubChem CID | 137007500 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | methyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]acetate |
| SMILES | COC(=O)CN(C)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H10ClN3O3/c1-12(3-5(13)15-2)7-6(9)8(14)11-4-10-7/h4H,3H2,1-2H3,(H,10,11,14) |
| InChIKey | GPSBKPIGEUSWPI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |