C9H12IN3O3 — CID 137007656
methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]propanoate (PubChem CID 137007656) has the molecular formula C9H12IN3O3 and a molecular weight of 337.12 g/mol. Its IUPAC name is methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]propanoate.
| Compound Name | methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]propanoate |
|---|---|
| PubChem CID | 137007656 |
| Molecular Formula | C9H12IN3O3 |
| Molecular Weight | 337.12 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | methyl 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H12IN3O3/c1-13(4-3-6(14)16-2)8-7(10)9(15)12-5-11-8/h5H,3-4H2,1-2H3,(H,11,12,15) |
| InChIKey | BOSAJUFXPSMCPV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.12 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|