C12H20IN3O3 — CID 136958061
4-[bis(2-ethoxyethyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136958061) has the molecular formula C12H20IN3O3 and a molecular weight of 381.21 g/mol. Its IUPAC name is 4-[bis(2-ethoxyethyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[bis(2-ethoxyethyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136958061 |
| Molecular Formula | C12H20IN3O3 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 4-[bis(2-ethoxyethyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCOCCN(CCOCC)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C12H20IN3O3/c1-3-18-7-5-16(6-8-19-4-2)11-10(13)12(17)15-9-14-11/h9H,3-8H2,1-2H3,(H,14,15,17) |
| InChIKey | LQUQKGXRINBENC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|