C8H9F3IN3O2 — CID 136737805
4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136737805) has the molecular formula C8H9F3IN3O2 and a molecular weight of 363.08 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136737805 |
| Molecular Formula | C8H9F3IN3O2 |
| Molecular Weight | 363.08 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N(CCO)CC(F)(F)F)c1I |
| InChI | InChI=1S/C8H9F3IN3O2/c9-8(10,11)3-15(1-2-16)6-5(12)7(17)14-4-13-6/h4,16H,1-3H2,(H,13,14,17) |
| InChIKey | KWFAARVDDOKFAM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.08 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|