C9H14IN3O — CID 136993915
4-[butyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136993915) has the molecular formula C9H14IN3O and a molecular weight of 307.14 g/mol. Its IUPAC name is 4-[butyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[butyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136993915 |
| Molecular Formula | C9H14IN3O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4-[butyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCCCN(C)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H14IN3O/c1-3-4-5-13(2)8-7(10)9(14)12-6-11-8/h6H,3-5H2,1-2H3,(H,11,12,14) |
| InChIKey | NROQWKSMBFXPHC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|