C13H14IN3O2 — CID 136970981
5-iodo-4-[(4-methoxyphenyl)methyl-methylamino]-1H-pyrimidin-6-one (PubChem CID 136970981) has the molecular formula C13H14IN3O2 and a molecular weight of 371.18 g/mol. Its IUPAC name is 5-iodo-4-[(4-methoxyphenyl)methyl-methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(4-methoxyphenyl)methyl-methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970981 |
| Molecular Formula | C13H14IN3O2 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 5-iodo-4-[(4-methoxyphenyl)methyl-methylamino]-1H-pyrimidin-6-one |
| SMILES | COc1ccc(CN(C)c2nc[nH]c(=O)c2I)cc1 |
| InChI | InChI=1S/C13H14IN3O2/c1-17(12-11(14)13(18)16-8-15-12)7-9-3-5-10(19-2)6-4-9/h3-6,8H,7H2,1-2H3,(H,15,16,18) |
| InChIKey | BQGYNWVBJROPOH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|