C11H19IN4O — CID 136978684
4-[(3-amino-2,2-dimethylpropyl)-ethylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136978684) has the molecular formula C11H19IN4O and a molecular weight of 350.20 g/mol. Its IUPAC name is 4-[(3-amino-2,2-dimethylpropyl)-ethylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(3-amino-2,2-dimethylpropyl)-ethylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136978684 |
| Molecular Formula | C11H19IN4O |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 4-[(3-amino-2,2-dimethylpropyl)-ethylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCN(CC(C)(C)CN)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H19IN4O/c1-4-16(6-11(2,3)5-13)9-8(12)10(17)15-7-14-9/h7H,4-6,13H2,1-3H3,(H,14,15,17) |
| InChIKey | ULOIEDOCNYWZQF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|