C7H7IN2O3S — CID 114791103
methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetate (PubChem CID 114791103) has the molecular formula C7H7IN2O3S and a molecular weight of 326.12 g/mol. Its IUPAC name is methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetate.
| Compound Name | methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 114791103 |
| Molecular Formula | C7H7IN2O3S |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 325.92 |
| IUPAC Name | methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C7H7IN2O3S/c1-13-4(11)2-14-7-5(8)6(12)9-3-10-7/h3H,2H2,1H3,(H,9,10,12) |
| InChIKey | IJYVMVZFAKFMMJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|