C9H13N3O3S — CID 114574111
methyl 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoate (PubChem CID 114574111) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is methyl 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoate.
| Compound Name | methyl 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 114574111 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | methyl 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]butanoate |
| SMILES | COC(=O)CC(C)Sc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H13N3O3S/c1-5(3-6(13)15-2)16-9-7(10)8(14)11-4-12-9/h4-5H,3,10H2,1-2H3,(H,11,12,14) |
| InChIKey | IWXXOUSIDVFUBM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |