C10H13N3O5S — CID 107775172
(2R)-2-acetamido-3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid (PubChem CID 107775172) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107775172 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (2R)-2-acetamido-3-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid |
| SMILES | COc1c(SC[C@H](NC(C)=O)C(=O)O)nc[nH]c1=O |
| InChI | InChI=1S/C10H13N3O5S/c1-5(14)13-6(10(16)17)3-19-9-7(18-2)8(15)11-4-12-9/h4,6H,3H2,1-2H3,(H,13,14)(H,16,17)(H,11,12,15)/t6-/m0/s1 |
| InChIKey | ALMLKTNAKBEYKX-LURJTMIESA-N |
| XLogP | -0.54 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |