C9H10IN3O3S — CID 107775365
(2R)-2-acetamido-3-(5-iodopyrimidin-4-yl)sulfanylpropanoic acid (PubChem CID 107775365) has the molecular formula C9H10IN3O3S and a molecular weight of 367.17 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(5-iodopyrimidin-4-yl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-(5-iodopyrimidin-4-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107775365 |
| Molecular Formula | C9H10IN3O3S |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | (2R)-2-acetamido-3-(5-iodopyrimidin-4-yl)sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSc1ncncc1I)C(=O)O |
| InChI | InChI=1S/C9H10IN3O3S/c1-5(14)13-7(9(15)16)3-17-8-6(10)2-11-4-12-8/h2,4,7H,3H2,1H3,(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | WANFTKGXEBRCRT-ZETCQYMHSA-N |
| XLogP | 0.76 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|