C11H11F3N2O3S — CID 107768555
2-acetamido-3-[[3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid (PubChem CID 107768555) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-acetamido-3-[[3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[[3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107768555 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-acetamido-3-[[3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSc1ncccc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H11F3N2O3S/c1-6(17)16-8(10(18)19)5-20-9-7(11(12,13)14)3-2-4-15-9/h2-4,8H,5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | RYIQFKURLWWRRJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |