C12H20ClN3O2 — CID 136971115
5-chloro-4-[2-methoxyethyl(pentan-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136971115) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is 5-chloro-4-[2-methoxyethyl(pentan-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-methoxyethyl(pentan-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971115 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 5-chloro-4-[2-methoxyethyl(pentan-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CCC(CC)N(CCOC)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C12H20ClN3O2/c1-4-9(5-2)16(6-7-18-3)11-10(13)12(17)15-8-14-11/h8-9H,4-7H2,1-3H3,(H,14,15,17) |
| InChIKey | NDVMUEDWZISFLI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |