C13H21N3O3 — CID 62702545
3-[2-methoxyethyl(pentan-3-yl)amino]pyrazine-2-carboxylic acid (PubChem CID 62702545) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-[2-methoxyethyl(pentan-3-yl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 3-[2-methoxyethyl(pentan-3-yl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 62702545 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-[2-methoxyethyl(pentan-3-yl)amino]pyrazine-2-carboxylic acid |
| SMILES | CCC(CC)N(CCOC)c1nccnc1C(=O)O |
| InChI | InChI=1S/C13H21N3O3/c1-4-10(5-2)16(8-9-19-3)12-11(13(17)18)14-6-7-15-12/h6-7,10H,4-5,8-9H2,1-3H3,(H,17,18) |
| InChIKey | JZYJUANCTRKJCN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |