C12H20N4OS — CID 62685655
3-[butan-2-yl(2-methoxyethyl)amino]pyrazine-2-carbothioamide (PubChem CID 62685655) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 3-[butan-2-yl(2-methoxyethyl)amino]pyrazine-2-carbothioamide.
| Compound Name | 3-[butan-2-yl(2-methoxyethyl)amino]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 62685655 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[butan-2-yl(2-methoxyethyl)amino]pyrazine-2-carbothioamide |
| SMILES | CCC(C)N(CCOC)c1nccnc1C(N)=S |
| InChI | InChI=1S/C12H20N4OS/c1-4-9(2)16(7-8-17-3)12-10(11(13)18)14-5-6-15-12/h5-6,9H,4,7-8H2,1-3H3,(H2,13,18) |
| InChIKey | QPIODCRQSPMGHG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|