C12H21N5O — CID 62684039
3-[2-methoxyethyl(2-methylpropyl)amino]pyrazine-2-carboximidamide (PubChem CID 62684039) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[2-methoxyethyl(2-methylpropyl)amino]pyrazine-2-carboximidamide.
| Compound Name | 3-[2-methoxyethyl(2-methylpropyl)amino]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 62684039 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-[2-methoxyethyl(2-methylpropyl)amino]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccnc1N(CCOC)CC(C)C |
| InChI | InChI=1S/C12H21N5O/c1-9(2)8-17(6-7-18-3)12-10(11(13)14)15-4-5-16-12/h4-5,9H,6-8H2,1-3H3,(H3,13,14) |
| InChIKey | YMVVETGNUCRQMO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|