C11H18N4S — CID 62685111
3-(dipropylamino)pyrazine-2-carbothioamide (PubChem CID 62685111) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-(dipropylamino)pyrazine-2-carbothioamide.
| Compound Name | 3-(dipropylamino)pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 62685111 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 3-(dipropylamino)pyrazine-2-carbothioamide |
| SMILES | CCCN(CCC)c1nccnc1C(N)=S |
| InChI | InChI=1S/C11H18N4S/c1-3-7-15(8-4-2)11-9(10(12)16)13-5-6-14-11/h5-6H,3-4,7-8H2,1-2H3,(H2,12,16) |
| InChIKey | AQEPBUYBQBKZAQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|