C10H14N4O2S — CID 55103429
ethyl 2-[(3-carbamothioylpyrazin-2-yl)-methylamino]acetate (PubChem CID 55103429) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is ethyl 2-[(3-carbamothioylpyrazin-2-yl)-methylamino]acetate.
| Compound Name | ethyl 2-[(3-carbamothioylpyrazin-2-yl)-methylamino]acetate |
|---|---|
| PubChem CID | 55103429 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | ethyl 2-[(3-carbamothioylpyrazin-2-yl)-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)c1nccnc1C(N)=S |
| InChI | InChI=1S/C10H14N4O2S/c1-3-16-7(15)6-14(2)10-8(9(11)17)12-4-5-13-10/h4-5H,3,6H2,1-2H3,(H2,11,17) |
| InChIKey | IIUNFDJKIVFUJU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|