C11H16N4O2S — CID 55102898
methyl 2-[(3-carbamothioylpyrazin-2-yl)-propylamino]acetate (PubChem CID 55102898) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is methyl 2-[(3-carbamothioylpyrazin-2-yl)-propylamino]acetate.
| Compound Name | methyl 2-[(3-carbamothioylpyrazin-2-yl)-propylamino]acetate |
|---|---|
| PubChem CID | 55102898 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | methyl 2-[(3-carbamothioylpyrazin-2-yl)-propylamino]acetate |
| SMILES | CCCN(CC(=O)OC)c1nccnc1C(N)=S |
| InChI | InChI=1S/C11H16N4O2S/c1-3-6-15(7-8(16)17-2)11-9(10(12)18)13-4-5-14-11/h4-5H,3,6-7H2,1-2H3,(H2,12,18) |
| InChIKey | DRVDHHNQXPRGMM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|