C12H19N5S — CID 63210825
3-[methyl(2-pyrrolidin-1-ylethyl)amino]pyrazine-2-carbothioamide (PubChem CID 63210825) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 3-[methyl(2-pyrrolidin-1-ylethyl)amino]pyrazine-2-carbothioamide.
| Compound Name | 3-[methyl(2-pyrrolidin-1-ylethyl)amino]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 63210825 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-[methyl(2-pyrrolidin-1-ylethyl)amino]pyrazine-2-carbothioamide |
| SMILES | CN(CCN1CCCC1)c1nccnc1C(N)=S |
| InChI | InChI=1S/C12H19N5S/c1-16(8-9-17-6-2-3-7-17)12-10(11(13)18)14-4-5-15-12/h4-5H,2-3,6-9H2,1H3,(H2,13,18) |
| InChIKey | GALSIQREMCMDQI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|