C11H13F2N3 — CID 62532506
3-(6-amino-N-ethyl-2,3-difluoroanilino)propanenitrile (PubChem CID 62532506) has the molecular formula C11H13F2N3 and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-(6-amino-N-ethyl-2,3-difluoroanilino)propanenitrile.
| Compound Name | 3-(6-amino-N-ethyl-2,3-difluoroanilino)propanenitrile |
|---|---|
| PubChem CID | 62532506 |
| Molecular Formula | C11H13F2N3 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-(6-amino-N-ethyl-2,3-difluoroanilino)propanenitrile |
| SMILES | CCN(CCC#N)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H13F2N3/c1-2-16(7-3-6-14)11-9(15)5-4-8(12)10(11)13/h4-5H,2-3,7,15H2,1H3 |
| InChIKey | KJOCYXYUXUYEDZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|