C12H17N3 — CID 63062738
3-(3-amino-N-ethyl-2-methylanilino)propanenitrile (PubChem CID 63062738) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-(3-amino-N-ethyl-2-methylanilino)propanenitrile.
| Compound Name | 3-(3-amino-N-ethyl-2-methylanilino)propanenitrile |
|---|---|
| PubChem CID | 63062738 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-(3-amino-N-ethyl-2-methylanilino)propanenitrile |
| SMILES | CCN(CCC#N)c1cccc(N)c1C |
| InChI | InChI=1S/C12H17N3/c1-3-15(9-5-8-13)12-7-4-6-11(14)10(12)2/h4,6-7H,3,5,9,14H2,1-2H3 |
| InChIKey | XLAIABNPEZKWBC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|