C12H14N2O2 — CID 55125536
2-[2-cyanoethyl(ethyl)amino]benzoic acid (PubChem CID 55125536) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[2-cyanoethyl(ethyl)amino]benzoic acid.
| Compound Name | 2-[2-cyanoethyl(ethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 55125536 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[2-cyanoethyl(ethyl)amino]benzoic acid |
| SMILES | CCN(CCC#N)c1ccccc1C(=O)O |
| InChI | InChI=1S/C12H14N2O2/c1-2-14(9-5-8-13)11-7-4-3-6-10(11)12(15)16/h3-4,6-7H,2,5,9H2,1H3,(H,15,16) |
| InChIKey | SGBUXIUQQHEANR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |