C12H13F2N3O3 — CID 103828734
3-[2,6-difluoro-N-(2-methoxyethyl)-4-nitroanilino]propanenitrile (PubChem CID 103828734) has the molecular formula C12H13F2N3O3 and a molecular weight of 285.25 g/mol. Its IUPAC name is 3-[2,6-difluoro-N-(2-methoxyethyl)-4-nitroanilino]propanenitrile.
| Compound Name | 3-[2,6-difluoro-N-(2-methoxyethyl)-4-nitroanilino]propanenitrile |
|---|---|
| PubChem CID | 103828734 |
| Molecular Formula | C12H13F2N3O3 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-[2,6-difluoro-N-(2-methoxyethyl)-4-nitroanilino]propanenitrile |
| SMILES | COCCN(CCC#N)c1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H13F2N3O3/c1-20-6-5-16(4-2-3-15)12-10(13)7-9(17(18)19)8-11(12)14/h7-8H,2,4-6H2,1H3 |
| InChIKey | ONTJTKLORYPMHW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|