C9H10F2OS — CID 164894235
2-ethoxy-1,3-difluoro-4-methylsulfanylbenzene (PubChem CID 164894235) has the molecular formula C9H10F2OS and a molecular weight of 204.24 g/mol. Its IUPAC name is 2-ethoxy-1,3-difluoro-4-methylsulfanylbenzene.
| Compound Name | 2-ethoxy-1,3-difluoro-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 164894235 |
| Molecular Formula | C9H10F2OS |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-ethoxy-1,3-difluoro-4-methylsulfanylbenzene |
| SMILES | CCOc1c(F)ccc(SC)c1F |
| InChI | InChI=1S/C9H10F2OS/c1-3-12-9-6(10)4-5-7(13-2)8(9)11/h4-5H,3H2,1-2H3 |
| InChIKey | PFLFQHHEFDVHOR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |