C8H7Br2FO — CID 118847248
1,2-dibromo-3-ethoxy-4-fluorobenzene (PubChem CID 118847248) has the molecular formula C8H7Br2FO and a molecular weight of 297.95 g/mol. Its IUPAC name is 1,2-dibromo-3-ethoxy-4-fluorobenzene.
| Compound Name | 1,2-dibromo-3-ethoxy-4-fluorobenzene |
|---|---|
| PubChem CID | 118847248 |
| Molecular Formula | C8H7Br2FO |
| Molecular Weight | 297.95 g/mol |
| Exact Mass | 295.88 |
| IUPAC Name | 1,2-dibromo-3-ethoxy-4-fluorobenzene |
| SMILES | CCOc1c(F)ccc(Br)c1Br |
| InChI | InChI=1S/C8H7Br2FO/c1-2-12-8-6(11)4-3-5(9)7(8)10/h3-4H,2H2,1H3 |
| InChIKey | XKDSEAYAFNKSFQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.95 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|