C16H6BF7O2 — CID 141042463
(4,5,6,7-tetrafluoronaphthalen-1-yl)-(2,3,6-trifluorophenoxy)borinic acid (PubChem CID 141042463) has the molecular formula C16H6BF7O2 and a molecular weight of 374.02 g/mol. Its IUPAC name is (4,5,6,7-tetrafluoronaphthalen-1-yl)-(2,3,6-trifluorophenoxy)borinic acid.
| Compound Name | (4,5,6,7-tetrafluoronaphthalen-1-yl)-(2,3,6-trifluorophenoxy)borinic acid |
|---|---|
| PubChem CID | 141042463 |
| Molecular Formula | C16H6BF7O2 |
| Molecular Weight | 374.02 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (4,5,6,7-tetrafluoronaphthalen-1-yl)-(2,3,6-trifluorophenoxy)borinic acid |
| SMILES | OB(Oc1c(F)ccc(F)c1F)c1ccc(F)c2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C16H6BF7O2/c18-8-2-1-7(6-5-11(21)13(22)15(24)12(6)8)17(25)26-16-10(20)4-3-9(19)14(16)23/h1-5,25H |
| InChIKey | XFEPUUXDPNTVMQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.02 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|