C28H11BF8O2 — CID 141042621
(2,3,4,5,6-pentafluoropyren-1-yl)oxy-[2-(2,3,5-trifluorophenyl)phenyl]borinic acid (PubChem CID 141042621) has the molecular formula C28H11BF8O2 and a molecular weight of 542.19 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluoropyren-1-yl)oxy-[2-(2,3,5-trifluorophenyl)phenyl]borinic acid.
| Compound Name | (2,3,4,5,6-pentafluoropyren-1-yl)oxy-[2-(2,3,5-trifluorophenyl)phenyl]borinic acid |
|---|---|
| PubChem CID | 141042621 |
| Molecular Formula | C28H11BF8O2 |
| Molecular Weight | 542.19 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | (2,3,4,5,6-pentafluoropyren-1-yl)oxy-[2-(2,3,5-trifluorophenyl)phenyl]borinic acid |
| SMILES | OB(Oc1c(F)c(F)c2c(F)c(F)c3c(F)ccc4ccc1c2c43)c1ccccc1-c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C28H11BF8O2/c30-12-9-15(23(33)18(32)10-12)13-3-1-2-4-16(13)29(38)39-28-14-7-5-11-6-8-17(31)21-19(11)20(14)22(25(35)24(21)34)26(36)27(28)37/h1-10,38H |
| InChIKey | SSLPOHZHSKPOKJ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.19 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|