C12H9BF2O2 — CID 22288640
[2-(2,4-difluorophenyl)phenyl]boronic acid (PubChem CID 22288640) has the molecular formula C12H9BF2O2 and a molecular weight of 234.01 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)phenyl]boronic acid.
| Compound Name | [2-(2,4-difluorophenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 22288640 |
| Molecular Formula | C12H9BF2O2 |
| Molecular Weight | 234.01 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [2-(2,4-difluorophenyl)phenyl]boronic acid |
| SMILES | OB(O)c1ccccc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C12H9BF2O2/c14-8-5-6-10(12(15)7-8)9-3-1-2-4-11(9)13(16)17/h1-7,16-17H |
| InChIKey | QZHPHFKRMJSRKD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.01 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|