[2-(2-hydroxyphenyl)phenyl]boronic acid

C12H11BO3 — CID 154274054

IUPAC[2-(2-hydroxyphenyl)phenyl]boronic acid
SMILESOB(O)c1ccccc1-c1ccccc1O
InChIInChI=1S/C12H11BO3/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1-8,14-16H
InChIKeySNDCKYSIYBTARI-UHFFFAOYSA-N
MW214.03 g/mol
LogP0.74
Rot. Bonds2

About [2-(2-hydroxyphenyl)phenyl]boronic acid

[2-(2-hydroxyphenyl)phenyl]boronic acid (PubChem CID 154274054) has the molecular formula C12H11BO3 and a molecular weight of 214.03 g/mol. Its IUPAC name is [2-(2-hydroxyphenyl)phenyl]boronic acid.

Molecular Properties

Compound Name[2-(2-hydroxyphenyl)phenyl]boronic acid
PubChem CID154274054
Molecular FormulaC12H11BO3
Molecular Weight214.03 g/mol
Exact Mass214.08
IUPAC Name[2-(2-hydroxyphenyl)phenyl]boronic acid
SMILESOB(O)c1ccccc1-c1ccccc1O
InChIInChI=1S/C12H11BO3/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1-8,14-16H
InChIKeySNDCKYSIYBTARI-UHFFFAOYSA-N
XLogP0.74
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.03
LogP ≤ 50.74
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-(2-hydroxyphenyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

[2-(2-bromophenyl)phenyl]boronic acid
CID 130113640
(2-naphthalen-1-ylphenyl)boronic acid
CID 66736681
2-(2-hydroxyphenyl)phenol;naphthalene
CID 70386801
[2-(2-pyridin-2-ylphenyl)phenyl]boronic acid
CID 175560830
[2-(2,4-difluorophenyl)phenyl]boronic acid
CID 22288640
[2-[2-[2-(3,5-ditert-butylphenyl)phenyl]phenyl]phenyl]boronic acid
CID 175206253
[2-(3-phenylphenyl)phenyl]boronic acid
CID 23033858
[2-(2-dimethylboranylphenyl)phenyl]-dimethylborane
CID 21029021
2-(4-methylnaphthalen-1-yl)phenol
CID 53405208
(2-pyren-1-ylphenyl)boronic acid
CID 87586549
[2-(3,5,6-triphenylpyrazin-2-yl)phenyl]boronic acid
CID 154791888
[2-(2-bromo-4,5-dimethoxyphenyl)phenyl]boronic acid
CID 135042244

Frequently Asked Questions

What is the IUPAC name of [2-(2-hydroxyphenyl)phenyl]boronic acid?
The IUPAC name of [2-(2-hydroxyphenyl)phenyl]boronic acid (CID 154274054) is [2-(2-hydroxyphenyl)phenyl]boronic acid.
What is the SMILES notation for [2-(2-hydroxyphenyl)phenyl]boronic acid?
The canonical SMILES for [2-(2-hydroxyphenyl)phenyl]boronic acid is OB(O)c1ccccc1-c1ccccc1O.
What is the InChIKey of [2-(2-hydroxyphenyl)phenyl]boronic acid?
The InChIKey is SNDCKYSIYBTARI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BO3/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1-8,14-16H.
What are the key properties of [2-(2-hydroxyphenyl)phenyl]boronic acid?
[2-(2-hydroxyphenyl)phenyl]boronic acid has a molecular weight of 214.03 g/mol, XLogP of 0.74, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-hydroxyphenyl)phenyl]boronic acid is sourced from PubChem (CID 154274054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).