C14H14BBrO4 — CID 135042244
[2-(2-bromo-4,5-dimethoxyphenyl)phenyl]boronic acid (PubChem CID 135042244) has the molecular formula C14H14BBrO4 and a molecular weight of 336.98 g/mol. Its IUPAC name is [2-(2-bromo-4,5-dimethoxyphenyl)phenyl]boronic acid.
| Compound Name | [2-(2-bromo-4,5-dimethoxyphenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 135042244 |
| Molecular Formula | C14H14BBrO4 |
| Molecular Weight | 336.98 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | [2-(2-bromo-4,5-dimethoxyphenyl)phenyl]boronic acid |
| SMILES | COc1cc(Br)c(-c2ccccc2B(O)O)cc1OC |
| InChI | InChI=1S/C14H14BBrO4/c1-19-13-7-10(12(16)8-14(13)20-2)9-5-3-4-6-11(9)15(17)18/h3-8,17-18H,1-2H3 |
| InChIKey | GMOYVILZUFVOEQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.98 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|