C14H15BO4 — CID 135023624
[2-(3,4-dimethoxyphenyl)phenyl]boronic acid (PubChem CID 135023624) has the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)phenyl]boronic acid.
| Compound Name | [2-(3,4-dimethoxyphenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 135023624 |
| Molecular Formula | C14H15BO4 |
| Molecular Weight | 258.08 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)phenyl]boronic acid |
| SMILES | COc1ccc(-c2ccccc2B(O)O)cc1OC |
| InChI | InChI=1S/C14H15BO4/c1-18-13-8-7-10(9-14(13)19-2)11-5-3-4-6-12(11)15(16)17/h3-9,16-17H,1-2H3 |
| InChIKey | OCLFTYYETRUFLU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.08 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|