C15H16N2O2 — CID 168529643
[2-(3,4-dimethoxyphenyl)phenyl]methylidenehydrazine (PubChem CID 168529643) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)phenyl]methylidenehydrazine.
| Compound Name | [2-(3,4-dimethoxyphenyl)phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 168529643 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)phenyl]methylidenehydrazine |
| SMILES | COc1ccc(-c2ccccc2C=NN)cc1OC |
| InChI | InChI=1S/C15H16N2O2/c1-18-14-8-7-11(9-15(14)19-2)13-6-4-3-5-12(13)10-17-16/h3-10H,16H2,1-2H3 |
| InChIKey | UXYMADBEBJBUPZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|