C8H10Cl2MnN2O2 — CID 162116939
manganese(2+);2-methanehydrazonoyl-6-methoxyphenol;dichloride (PubChem CID 162116939) has the molecular formula C8H10Cl2MnN2O2 and a molecular weight of 292.02 g/mol. Its IUPAC name is manganese(2+);2-methanehydrazonoyl-6-methoxyphenol;dichloride.
| Compound Name | manganese(2+);2-methanehydrazonoyl-6-methoxyphenol;dichloride |
|---|---|
| PubChem CID | 162116939 |
| Molecular Formula | C8H10Cl2MnN2O2 |
| Molecular Weight | 292.02 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | manganese(2+);2-methanehydrazonoyl-6-methoxyphenol;dichloride |
| SMILES | COc1cccc(C=NN)c1O.[Cl-].[Cl-].[Mn+2] |
| InChI | InChI=1S/C8H10N2O2.2ClH.Mn/c1-12-7-4-2-3-6(5-10-9)8(7)11;;;/h2-5,11H,9H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FLWDHJODWUJYAY-UHFFFAOYSA-L |
| XLogP | -5.30 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.02 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|