C11H11N3S — CID 168530301
[2-(3-methyl-1,2-thiazol-5-yl)phenyl]methylidenehydrazine (PubChem CID 168530301) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is [2-(3-methyl-1,2-thiazol-5-yl)phenyl]methylidenehydrazine.
| Compound Name | [2-(3-methyl-1,2-thiazol-5-yl)phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 168530301 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | [2-(3-methyl-1,2-thiazol-5-yl)phenyl]methylidenehydrazine |
| SMILES | Cc1cc(-c2ccccc2C=NN)sn1 |
| InChI | InChI=1S/C11H11N3S/c1-8-6-11(15-14-8)10-5-3-2-4-9(10)7-13-12/h2-7H,12H2,1H3 |
| InChIKey | LBRRUTSSUUMIEQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|