C19H17Br2NO5 — CID 10767664
4,5-bis(2-bromo-4,5-dimethoxyphenyl)-1,2-oxazole (PubChem CID 10767664) has the molecular formula C19H17Br2NO5 and a molecular weight of 499.16 g/mol. Its IUPAC name is 4,5-bis(2-bromo-4,5-dimethoxyphenyl)-1,2-oxazole.
| Compound Name | 4,5-bis(2-bromo-4,5-dimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 10767664 |
| Molecular Formula | C19H17Br2NO5 |
| Molecular Weight | 499.16 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | 4,5-bis(2-bromo-4,5-dimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1cc(Br)c(-c2cnoc2-c2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C19H17Br2NO5/c1-23-15-5-10(13(20)7-17(15)25-3)12-9-22-27-19(12)11-6-16(24-2)18(26-4)8-14(11)21/h5-9H,1-4H3 |
| InChIKey | ZKYVNRRTFPPGAP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.16 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |