C32H35BO2 — CID 175206253
[2-[2-[2-(3,5-ditert-butylphenyl)phenyl]phenyl]phenyl]boronic acid (PubChem CID 175206253) has the molecular formula C32H35BO2 and a molecular weight of 462.44 g/mol. Its IUPAC name is [2-[2-[2-(3,5-ditert-butylphenyl)phenyl]phenyl]phenyl]boronic acid.
| Compound Name | [2-[2-[2-(3,5-ditert-butylphenyl)phenyl]phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 175206253 |
| Molecular Formula | C32H35BO2 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | [2-[2-[2-(3,5-ditert-butylphenyl)phenyl]phenyl]phenyl]boronic acid |
| SMILES | CC(C)(C)c1cc(-c2ccccc2-c2ccccc2-c2ccccc2B(O)O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H35BO2/c1-31(2,3)23-19-22(20-24(21-23)32(4,5)6)25-13-7-8-14-26(25)27-15-9-10-16-28(27)29-17-11-12-18-30(29)33(34)35/h7-21,34-35H,1-6H3 |
| InChIKey | VYOJOJLMSMAMEG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|