C32H31Br2N — CID 169284775
3,6-dibromo-9-[2-(3,5-ditert-butylphenyl)phenyl]carbazole (PubChem CID 169284775) has the molecular formula C32H31Br2N and a molecular weight of 589.42 g/mol. Its IUPAC name is 3,6-dibromo-9-[2-(3,5-ditert-butylphenyl)phenyl]carbazole.
| Compound Name | 3,6-dibromo-9-[2-(3,5-ditert-butylphenyl)phenyl]carbazole |
|---|---|
| PubChem CID | 169284775 |
| Molecular Formula | C32H31Br2N |
| Molecular Weight | 589.42 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | 3,6-dibromo-9-[2-(3,5-ditert-butylphenyl)phenyl]carbazole |
| SMILES | CC(C)(C)c1cc(-c2ccccc2-n2c3ccc(Br)cc3c3cc(Br)ccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H31Br2N/c1-31(2,3)21-15-20(16-22(17-21)32(4,5)6)25-9-7-8-10-28(25)35-29-13-11-23(33)18-26(29)27-19-24(34)12-14-30(27)35/h7-19H,1-6H3 |
| InChIKey | SNXXNNJIKKLAGI-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.42 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |