C75H81N5 — CID 155636636
9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]-3,6-ditert-butylcarbazole (PubChem CID 155636636) has the molecular formula C75H81N5 and a molecular weight of 1052.51 g/mol. Its IUPAC name is 9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]-3,6-ditert-butylcarbazole.
| Compound Name | 9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]-3,6-ditert-butylcarbazole |
|---|---|
| PubChem CID | 155636636 |
| Molecular Formula | C75H81N5 |
| Molecular Weight | 1052.51 g/mol |
| Exact Mass | 1051.65 |
| IUPAC Name | 9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]-3,6-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3ccc(-n4c5ccccc5c5ccccc54)c(-c4ccccc4-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)c3)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C75H81N5/c1-70(2,3)49-32-35-65-59(44-49)60-45-50(71(4,5)6)33-36-66(60)80(65)63-30-24-21-27-57(63)58-41-46(31-34-64(58)79-61-28-22-19-25-55(61)56-26-20-23-29-62(56)79)67-76-68(47-37-51(72(7,8)9)42-52(38-47)73(10,11)12)78-69(77-67)48-39-53(74(13,14)15)43-54(40-48)75(16,17)18/h19-45H,1-18H3 |
| InChIKey | NNMUIVRAVLEJAS-UHFFFAOYSA-N |
| XLogP | 20.52 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1052.51 |
| LogP ≤ 5 | 20.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |