C69H69N5 — CID 155636691
9-[2-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(2-carbazol-9-ylphenyl)phenyl]-3,6-dimethylcarbazole (PubChem CID 155636691) has the molecular formula C69H69N5 and a molecular weight of 968.35 g/mol. Its IUPAC name is 9-[2-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(2-carbazol-9-ylphenyl)phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[2-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(2-carbazol-9-ylphenyl)phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 155636691 |
| Molecular Formula | C69H69N5 |
| Molecular Weight | 968.35 g/mol |
| Exact Mass | 967.56 |
| IUPAC Name | 9-[2-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(2-carbazol-9-ylphenyl)phenyl]-3,6-dimethylcarbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(-c2ccccc2-n2c3ccccc3c3ccccc32)cc1-c1nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C69H69N5/c1-42-27-30-60-54(33-42)55-34-43(2)28-31-61(55)74(60)62-32-29-44(51-21-15-18-24-57(51)73-58-25-19-16-22-52(58)53-23-17-20-26-59(53)73)39-56(62)65-71-63(45-35-47(66(3,4)5)40-48(36-45)67(6,7)8)70-64(72-65)46-37-49(68(9,10)11)41-50(38-46)69(12,13)14/h15-41H,1-14H3 |
| InChIKey | JIYVFFRWLKXUSK-UHFFFAOYSA-N |
| XLogP | 18.54 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.35 |
| LogP ≤ 5 | 18.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |