C68H65N7 — CID 161040267
9-[4-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-[4-(3-isocyanocarbazol-9-yl)-3-pyridinyl]phenyl]-3-methylcarbazole (PubChem CID 161040267) has the molecular formula C68H65N7 and a molecular weight of 980.32 g/mol. Its IUPAC name is 9-[4-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-[4-(3-isocyanocarbazol-9-yl)-3-pyridinyl]phenyl]-3-methylcarbazole.
| Compound Name | 9-[4-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-[4-(3-isocyanocarbazol-9-yl)-3-pyridinyl]phenyl]-3-methylcarbazole |
|---|---|
| PubChem CID | 161040267 |
| Molecular Formula | C68H65N7 |
| Molecular Weight | 980.32 g/mol |
| Exact Mass | 979.53 |
| IUPAC Name | 9-[4-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-[4-(3-isocyanocarbazol-9-yl)-3-pyridinyl]phenyl]-3-methylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccncc1-c1cc(-c2nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)n2)ccc1-n1c2ccccc2c2cc(C)ccc21 |
| InChI | InChI=1S/C68H65N7/c1-41-23-26-58-52(31-41)50-19-15-17-21-56(50)74(58)59-27-24-42(36-53(59)55-40-70-30-29-61(55)75-57-22-18-16-20-51(57)54-39-49(69-14)25-28-60(54)75)62-71-63(43-32-45(65(2,3)4)37-46(33-43)66(5,6)7)73-64(72-62)44-34-47(67(8,9)10)38-48(35-44)68(11,12)13/h15-40H,1-13H3 |
| InChIKey | HTOGCZHOFZHMPQ-UHFFFAOYSA-N |
| XLogP | 18.18 |
| TPSA | 65.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.32 |
| LogP ≤ 5 | 18.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|