C79H73N5 — CID 155636561
9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(3-phenylcarbazol-9-yl)phenyl]phenyl]-3-phenylcarbazole (PubChem CID 155636561) has the molecular formula C79H73N5 and a molecular weight of 1092.49 g/mol. Its IUPAC name is 9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(3-phenylcarbazol-9-yl)phenyl]phenyl]-3-phenylcarbazole.
| Compound Name | 9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(3-phenylcarbazol-9-yl)phenyl]phenyl]-3-phenylcarbazole |
|---|---|
| PubChem CID | 155636561 |
| Molecular Formula | C79H73N5 |
| Molecular Weight | 1092.49 g/mol |
| Exact Mass | 1091.59 |
| IUPAC Name | 9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-(3-phenylcarbazol-9-yl)phenyl]phenyl]-3-phenylcarbazole |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3cc(-c4ccccc4-n4c5ccccc5c5cc(-c6ccccc6)ccc54)ccc3-n3c4ccccc4c4cc(-c5ccccc5)ccc43)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C79H73N5/c1-76(2,3)57-41-55(42-58(48-57)77(4,5)6)73-80-74(56-43-59(78(7,8)9)49-60(44-56)79(10,11)12)82-75(81-73)66-47-54(37-40-72(66)84-69-34-24-21-31-63(69)65-46-53(36-39-71(65)84)51-27-17-14-18-28-51)61-29-19-22-32-67(61)83-68-33-23-20-30-62(68)64-45-52(35-38-70(64)83)50-25-15-13-16-26-50/h13-49H,1-12H3 |
| InChIKey | IRJNGOAVCWKWQB-UHFFFAOYSA-N |
| XLogP | 21.26 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1092.49 |
| LogP ≤ 5 | 21.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |