C79H74N6 — CID 155636551
9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-carbazol-9-ylphenyl]phenyl]-N,N-diphenylcarbazol-3-amine (PubChem CID 155636551) has the molecular formula C79H74N6 and a molecular weight of 1107.50 g/mol. Its IUPAC name is 9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-carbazol-9-ylphenyl]phenyl]-N,N-diphenylcarbazol-3-amine.
| Compound Name | 9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-carbazol-9-ylphenyl]phenyl]-N,N-diphenylcarbazol-3-amine |
|---|---|
| PubChem CID | 155636551 |
| Molecular Formula | C79H74N6 |
| Molecular Weight | 1107.50 g/mol |
| Exact Mass | 1106.60 |
| IUPAC Name | 9-[2-[3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-carbazol-9-ylphenyl]phenyl]-N,N-diphenylcarbazol-3-amine |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3cc(-c4ccccc4-n4c5ccccc5c5cc(N(c6ccccc6)c6ccccc6)ccc54)ccc3-n3c4ccccc4c4ccccc43)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C79H74N6/c1-76(2,3)54-43-52(44-55(48-54)77(4,5)6)73-80-74(53-45-56(78(7,8)9)49-57(46-53)79(10,11)12)82-75(81-73)66-47-51(39-41-72(66)85-68-36-24-20-32-62(68)63-33-21-25-37-69(63)85)61-31-19-23-35-67(61)84-70-38-26-22-34-64(70)65-50-60(40-42-71(65)84)83(58-27-15-13-16-28-58)59-29-17-14-18-30-59/h13-50H,1-12H3 |
| InChIKey | WJJOTVUXIAUHJY-UHFFFAOYSA-N |
| XLogP | 21.39 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.50 |
| LogP ≤ 5 | 21.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |