C83H77N5O4 — CID 155636620
dibenzyl 9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]carbazole-3,6-dicarboxylate (PubChem CID 155636620) has the molecular formula C83H77N5O4 and a molecular weight of 1208.56 g/mol. Its IUPAC name is dibenzyl 9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]carbazole-3,6-dicarboxylate.
| Compound Name | dibenzyl 9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]carbazole-3,6-dicarboxylate |
|---|---|
| PubChem CID | 155636620 |
| Molecular Formula | C83H77N5O4 |
| Molecular Weight | 1208.56 g/mol |
| Exact Mass | 1207.60 |
| IUPAC Name | dibenzyl 9-[2-[5-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-2-carbazol-9-ylphenyl]phenyl]carbazole-3,6-dicarboxylate |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3ccc(-n4c5ccccc5c5ccccc54)c(-c4ccccc4-n4c5ccc(C(=O)OCc6ccccc6)cc5c5cc(C(=O)OCc6ccccc6)ccc54)c3)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C83H77N5O4/c1-80(2,3)59-41-57(42-60(48-59)81(4,5)6)76-84-75(85-77(86-76)58-43-61(82(7,8)9)49-62(44-58)83(10,11)12)54-35-38-72(87-69-32-22-19-29-63(69)64-30-20-23-33-70(64)87)66(45-54)65-31-21-24-34-71(65)88-73-39-36-55(78(89)91-50-52-25-15-13-16-26-52)46-67(73)68-47-56(37-40-74(68)88)79(90)92-51-53-27-17-14-18-28-53/h13-49H,50-51H2,1-12H3 |
| InChIKey | ZCFYOKLQEBSLMV-UHFFFAOYSA-N |
| XLogP | 20.64 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1208.56 |
| LogP ≤ 5 | 20.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |