C93H104N2 — CID 169284686
2-[2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]phenyl]benzonitrile (PubChem CID 169284686) has the molecular formula C93H104N2 and a molecular weight of 1249.87 g/mol. Its IUPAC name is 2-[2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]phenyl]benzonitrile.
| Compound Name | 2-[2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 169284686 |
| Molecular Formula | C93H104N2 |
| Molecular Weight | 1249.87 g/mol |
| Exact Mass | 1248.82 |
| IUPAC Name | 2-[2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]phenyl]benzonitrile |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3ccc4c(c3)c3cc(-c5cc(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)cc(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c5)ccc3n4-c3ccccc3-c3ccccc3C#N)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C93H104N2/c1-86(2,3)71-43-67(44-72(53-71)87(4,5)6)63-37-61(38-64(41-63)68-45-73(88(7,8)9)54-74(46-68)89(10,11)12)58-33-35-84-81(51-58)82-52-59(34-36-85(82)95(84)83-32-28-27-31-80(83)79-30-26-25-29-60(79)57-94)62-39-65(69-47-75(90(13,14)15)55-76(48-69)91(16,17)18)42-66(40-62)70-49-77(92(19,20)21)56-78(50-70)93(22,23)24/h25-56H,1-24H3 |
| InChIKey | ASAPSMPBDHZNGB-UHFFFAOYSA-N |
| XLogP | 26.70 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 95 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1249.87 |
| LogP ≤ 5 | 26.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |