C94H103F6N — CID 169284714
3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]-9-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]carbazole (PubChem CID 169284714) has the molecular formula C94H103F6N and a molecular weight of 1360.85 g/mol. Its IUPAC name is 3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]-9-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]carbazole.
| Compound Name | 3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]-9-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 169284714 |
| Molecular Formula | C94H103F6N |
| Molecular Weight | 1360.85 g/mol |
| Exact Mass | 1359.80 |
| IUPAC Name | 3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]-9-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]carbazole |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3ccc4c(c3)c3cc(-c5cc(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)cc(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c5)ccc3n4-c3ccccc3-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C94H103F6N/c1-85(2,3)69-39-64(40-70(51-69)86(4,5)6)60-33-58(34-61(37-60)65-41-71(87(7,8)9)52-72(42-65)88(10,11)12)56-29-31-83-80(49-56)81-50-57(30-32-84(81)101(83)82-28-26-25-27-79(82)68-47-77(93(95,96)97)55-78(48-68)94(98,99)100)59-35-62(66-43-73(89(13,14)15)53-74(44-66)90(16,17)18)38-63(36-59)67-45-75(91(19,20)21)54-76(46-67)92(22,23)24/h25-55H,1-24H3 |
| InChIKey | ZITNDEQATFBYPJ-UHFFFAOYSA-N |
| XLogP | 28.87 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 101 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1360.85 |
| LogP ≤ 5 | 28.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |