C68H33F24N — CID 170285922
3,6-bis[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-9-(2-phenylphenyl)carbazole (PubChem CID 170285922) has the molecular formula C68H33F24N and a molecular weight of 1319.97 g/mol. Its IUPAC name is 3,6-bis[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-9-(2-phenylphenyl)carbazole.
| Compound Name | 3,6-bis[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-9-(2-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 170285922 |
| Molecular Formula | C68H33F24N |
| Molecular Weight | 1319.97 g/mol |
| Exact Mass | 1319.22 |
| IUPAC Name | 3,6-bis[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-9-(2-phenylphenyl)carbazole |
| SMILES | FC(F)(F)c1cc(-c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc(-c3ccc4c(c3)c3cc(-c5cc(-c6cc(C(F)(F)F)cc(C(F)(F)F)c6)cc(-c6cc(C(F)(F)F)cc(C(F)(F)F)c6)c5)ccc3n4-c3ccccc3-c3ccccc3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C68H33F24N/c69-61(70,71)47-20-43(21-48(30-47)62(72,73)74)39-14-37(15-40(18-39)44-22-49(63(75,76)77)31-50(23-44)64(78,79)80)35-10-12-59-56(28-35)57-29-36(11-13-60(57)93(59)58-9-5-4-8-55(58)34-6-2-1-3-7-34)38-16-41(45-24-51(65(81,82)83)32-52(25-45)66(84,85)86)19-42(17-38)46-26-53(67(87,88)89)33-54(27-46)68(90,91)92/h1-33H |
| InChIKey | UDTWGFHHCQTZAO-UHFFFAOYSA-N |
| XLogP | 24.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1319.97 |
| LogP ≤ 5 | 24.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |