C87H100N2 — CID 169284889
2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]benzonitrile (PubChem CID 169284889) has the molecular formula C87H100N2 and a molecular weight of 1173.77 g/mol. Its IUPAC name is 2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]benzonitrile.
| Compound Name | 2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 169284889 |
| Molecular Formula | C87H100N2 |
| Molecular Weight | 1173.77 g/mol |
| Exact Mass | 1172.79 |
| IUPAC Name | 2-[3,6-bis[3,5-bis(3,5-ditert-butylphenyl)phenyl]carbazol-9-yl]benzonitrile |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3ccc4c(c3)c3cc(-c5cc(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)cc(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c5)ccc3n4-c3ccccc3C#N)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C87H100N2/c1-80(2,3)67-39-63(40-68(49-67)81(4,5)6)59-33-57(34-60(37-59)64-41-69(82(7,8)9)50-70(42-64)83(10,11)12)54-29-31-78-75(47-54)76-48-55(30-32-79(76)89(78)77-28-26-25-27-56(77)53-88)58-35-61(65-43-71(84(13,14)15)51-72(44-65)85(16,17)18)38-62(36-58)66-45-73(86(19,20)21)52-74(46-66)87(22,23)24/h25-52H,1-24H3 |
| InChIKey | RJRKOZGVBQXWBI-UHFFFAOYSA-N |
| XLogP | 25.04 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1173.77 |
| LogP ≤ 5 | 25.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |