C55H36N2 — CID 169284925
2-[3,6-bis[3,5-bis(4-deuteriophenyl)phenyl]carbazol-9-yl]benzonitrile (PubChem CID 169284925) has the molecular formula C55H36N2 and a molecular weight of 728.93 g/mol. Its IUPAC name is 2-[3,6-bis[3,5-bis(4-deuteriophenyl)phenyl]carbazol-9-yl]benzonitrile.
| Compound Name | 2-[3,6-bis[3,5-bis(4-deuteriophenyl)phenyl]carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 169284925 |
| Molecular Formula | C55H36N2 |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.31 |
| IUPAC Name | 2-[3,6-bis[3,5-bis(4-deuteriophenyl)phenyl]carbazol-9-yl]benzonitrile |
| SMILES | [2H]c1ccc(-c2cc(-c3ccc([2H])cc3)cc(-c3ccc4c(c3)c3cc(-c5cc(-c6ccc([2H])cc6)cc(-c6ccc([2H])cc6)c5)ccc3n4-c3ccccc3C#N)c2)cc1 |
| InChI | InChI=1S/C55H36N2/c56-37-44-23-13-14-24-53(44)57-54-27-25-42(49-31-45(38-15-5-1-6-16-38)29-46(32-49)39-17-7-2-8-18-39)35-51(54)52-36-43(26-28-55(52)57)50-33-47(40-19-9-3-10-20-40)30-48(34-50)41-21-11-4-12-22-41/h1-36H/i1D,2D,3D,4D |
| InChIKey | GGUJXBUEFXJCLF-RHQRLBAQSA-N |
| XLogP | 14.66 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |