C30H39N — CID 177078236
2-(4-tert-butylphenyl)-6-(3,5-ditert-butylphenyl)aniline (PubChem CID 177078236) has the molecular formula C30H39N and a molecular weight of 413.65 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-6-(3,5-ditert-butylphenyl)aniline.
| Compound Name | 2-(4-tert-butylphenyl)-6-(3,5-ditert-butylphenyl)aniline |
|---|---|
| PubChem CID | 177078236 |
| Molecular Formula | C30H39N |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | 2-(4-tert-butylphenyl)-6-(3,5-ditert-butylphenyl)aniline |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2N)cc1 |
| InChI | InChI=1S/C30H39N/c1-28(2,3)22-15-13-20(14-16-22)25-11-10-12-26(27(25)31)21-17-23(29(4,5)6)19-24(18-21)30(7,8)9/h10-19H,31H2,1-9H3 |
| InChIKey | FJAAHTBQNIAWGM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|